About (2S)-2-cyclohexylbutanal
(2S)-2-cyclohexylbutanal (PubChem CID 88959248) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (2S)-2-cyclohexylbutanal.
Molecular Properties
| Compound Name | (2S)-2-cyclohexylbutanal |
| PubChem CID | 88959248 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2S)-2-cyclohexylbutanal |
| SMILES | CC[C@H](C=O)C1CCCCC1 |
| InChI | InChI=1S/C10H18O/c1-2-9(8-11)10-6-4-3-5-7-10/h8-10H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | XIHMKRWZCFAKIF-SECBINFHSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-cyclohexylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-cyclohexylbutanal?
The IUPAC name of (2S)-2-cyclohexylbutanal (CID 88959248) is (2S)-2-cyclohexylbutanal.
What is the SMILES notation for (2S)-2-cyclohexylbutanal?
The canonical SMILES for (2S)-2-cyclohexylbutanal is CC[C@H](C=O)C1CCCCC1.
What is the InChIKey of (2S)-2-cyclohexylbutanal?
The InChIKey is XIHMKRWZCFAKIF-SECBINFHSA-N. The full InChI is InChI=1S/C10H18O/c1-2-9(8-11)10-6-4-3-5-7-10/h8-10H,2-7H2,1H3/t9-/m1/s1.
What are the key properties of (2S)-2-cyclohexylbutanal?
(2S)-2-cyclohexylbutanal has a molecular weight of 154.25 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-cyclohexylbutanal is sourced from PubChem (CID 88959248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).