C28H26F3N5O4 — CID 88959334
[4-[5-(2-acetamidoethylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate (PubChem CID 88959334) has the molecular formula C28H26F3N5O4 and a molecular weight of 553.54 g/mol. Its IUPAC name is [4-[5-(2-acetamidoethylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate.
| Compound Name | [4-[5-(2-acetamidoethylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 88959334 |
| Molecular Formula | C28H26F3N5O4 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | [4-[5-(2-acetamidoethylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate |
| SMILES | CC(=O)NCCNC(=O)c1nccc2nc(-c3ccc(C[NH3+])cc3)c(-c3ccccc3)cc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H25N5O2.C2HF3O2/c1-17(32)28-13-14-30-26(33)25-22-15-21(19-5-3-2-4-6-19)24(31-23(22)11-12-29-25)20-9-7-18(16-27)8-10-20;3-2(4,5)1(6)7/h2-12,15H,13-14,16,27H2,1H3,(H,28,32)(H,30,33);(H,6,7) |
| InChIKey | GFPRKDKMTQEAAL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|