C23H20F4N4O4 — CID 88959619
7-(4-methylimidazol-1-yl)-2-[(2S)-1-[(2,2,3,3-tetrafluoro-1-benzofuran-4-yl)oxy]propan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione (PubChem CID 88959619) has the molecular formula C23H20F4N4O4 and a molecular weight of 492.43 g/mol. Its IUPAC name is 7-(4-methylimidazol-1-yl)-2-[(2S)-1-[(2,2,3,3-tetrafluoro-1-benzofuran-4-yl)oxy]propan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione.
| Compound Name | 7-(4-methylimidazol-1-yl)-2-[(2S)-1-[(2,2,3,3-tetrafluoro-1-benzofuran-4-yl)oxy]propan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
|---|---|
| PubChem CID | 88959619 |
| Molecular Formula | C23H20F4N4O4 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 7-(4-methylimidazol-1-yl)-2-[(2S)-1-[(2,2,3,3-tetrafluoro-1-benzofuran-4-yl)oxy]propan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
| SMILES | Cc1cn(-c2ccc3n(c2=O)CCN([C@@H](C)COc2cccc4c2C(F)(F)C(F)(F)O4)C3=O)cn1 |
| InChI | InChI=1S/C23H20F4N4O4/c1-13-10-29(12-28-13)15-6-7-16-21(33)30(8-9-31(16)20(15)32)14(2)11-34-17-4-3-5-18-19(17)22(24,25)23(26,27)35-18/h3-7,10,12,14H,8-9,11H2,1-2H3/t14-/m0/s1 |
| InChIKey | HQJKLBDFDAAMMP-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|