C23H20F4N4O3 — CID 88959665
7-(4-methylimidazol-1-yl)-2-[2-[(2,2,3,3-tetrafluoro-1H-inden-4-yl)oxy]ethyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione (PubChem CID 88959665) has the molecular formula C23H20F4N4O3 and a molecular weight of 476.43 g/mol. Its IUPAC name is 7-(4-methylimidazol-1-yl)-2-[2-[(2,2,3,3-tetrafluoro-1H-inden-4-yl)oxy]ethyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione.
| Compound Name | 7-(4-methylimidazol-1-yl)-2-[2-[(2,2,3,3-tetrafluoro-1H-inden-4-yl)oxy]ethyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
|---|---|
| PubChem CID | 88959665 |
| Molecular Formula | C23H20F4N4O3 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 7-(4-methylimidazol-1-yl)-2-[2-[(2,2,3,3-tetrafluoro-1H-inden-4-yl)oxy]ethyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
| SMILES | Cc1cn(-c2ccc3n(c2=O)CCN(CCOc2cccc4c2C(F)(F)C(F)(F)C4)C3=O)cn1 |
| InChI | InChI=1S/C23H20F4N4O3/c1-14-12-30(13-28-14)16-5-6-17-20(32)29(7-8-31(17)21(16)33)9-10-34-18-4-2-3-15-11-22(24,25)23(26,27)19(15)18/h2-6,12-13H,7-11H2,1H3 |
| InChIKey | VKKNTPATVMWNHX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|