C19H16F9NO2S2 — CID 88959733
1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl]butane-1-sulfonamide (PubChem CID 88959733) has the molecular formula C19H16F9NO2S2 and a molecular weight of 525.46 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl]butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 88959733 |
| Molecular Formula | C19H16F9NO2S2 |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl]butane-1-sulfonamide |
| SMILES | CN(Cc1ccc(-c2ccc(CS)cc2)cc1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H16F9NO2S2/c1-29(33(30,31)19(27,28)17(22,23)16(20,21)18(24,25)26)10-12-2-6-14(7-3-12)15-8-4-13(11-32)5-9-15/h2-9,32H,10-11H2,1H3 |
| InChIKey | HJLNIDPHONYCDG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|