C26H23F6N5O5 — CID 88960050
N-(6-morpholin-4-yl-2-pyridinyl)-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 88960050) has the molecular formula C26H23F6N5O5 and a molecular weight of 599.49 g/mol. Its IUPAC name is N-(6-morpholin-4-yl-2-pyridinyl)-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(6-morpholin-4-yl-2-pyridinyl)-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 88960050 |
| Molecular Formula | C26H23F6N5O5 |
| Molecular Weight | 599.49 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | N-(6-morpholin-4-yl-2-pyridinyl)-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1cccc(N2CCOCC2)n1)N1CCOc2ccc(-c3cccc(C(F)(F)F)c3)nc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H22F3N5O3.C2HF3O2/c25-24(26,27)17-4-1-3-16(15-17)18-7-8-19-22(28-18)32(11-14-35-19)23(33)30-20-5-2-6-21(29-20)31-9-12-34-13-10-31;3-2(4,5)1(6)7/h1-8,15H,9-14H2,(H,29,30,33);(H,6,7) |
| InChIKey | SJDSHFQPIBNRPU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |