C38H42N4 — CID 88960279
9-methyl-N-[4-[5-[(9-methyl-1,8,8a,9a-tetrahydrocarbazol-2-yl)amino]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-2,3,4b,5-tetrahydrocarbazol-2-amine (PubChem CID 88960279) has the molecular formula C38H42N4 and a molecular weight of 554.78 g/mol. Its IUPAC name is 9-methyl-N-[4-[5-[(9-methyl-1,8,8a,9a-tetrahydrocarbazol-2-yl)amino]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-2,3,4b,5-tetrahydrocarbazol-2-amine.
| Compound Name | 9-methyl-N-[4-[5-[(9-methyl-1,8,8a,9a-tetrahydrocarbazol-2-yl)amino]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-2,3,4b,5-tetrahydrocarbazol-2-amine |
|---|---|
| PubChem CID | 88960279 |
| Molecular Formula | C38H42N4 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | 9-methyl-N-[4-[5-[(9-methyl-1,8,8a,9a-tetrahydrocarbazol-2-yl)amino]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-2,3,4b,5-tetrahydrocarbazol-2-amine |
| SMILES | CN1C2=CC(NC3=CC=C(C4=CC=CC(NC5=CC=C6C7=CC=CCC7N(C)C6C5)C4)CC3)CC=C2C2CC=CC=C21 |
| InChI | InChI=1S/C38H42N4/c1-41-35-12-5-3-10-31(35)33-20-18-29(23-37(33)41)39-27-16-14-25(15-17-27)26-8-7-9-28(22-26)40-30-19-21-34-32-11-4-6-13-36(32)42(2)38(34)24-30/h3-9,11-12,14,16,19-21,23,28-29,31,36,38-40H,10,13,15,17-18,22,24H2,1-2H3 |
| InChIKey | ZAKZMJWZDSUENX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |