About 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane
5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane (PubChem CID 88960394) has the molecular formula C20H32F4
and a molecular weight of 348.47 g/mol. Its IUPAC name is 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane.
Molecular Properties
| Compound Name | 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane |
| PubChem CID | 88960394 |
| Molecular Formula | C20H32F4 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane |
| SMILES | CCC1CCC(C2CCC(C3CC(F)C(F)C(F)C3)C(F)C2)CC1 |
| InChI | InChI=1S/C20H32F4/c1-2-12-3-5-13(6-4-12)14-7-8-16(17(21)9-14)15-10-18(22)20(24)19(23)11-15/h12-20H,2-11H2,1H3 |
| InChIKey | OMBRUVXIEFXBSX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane?
The IUPAC name of 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane (CID 88960394) is 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane.
What is the SMILES notation for 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane?
The canonical SMILES for 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane is CCC1CCC(C2CCC(C3CC(F)C(F)C(F)C3)C(F)C2)CC1.
What is the InChIKey of 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane?
The InChIKey is OMBRUVXIEFXBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32F4/c1-2-12-3-5-13(6-4-12)14-7-8-16(17(21)9-14)15-10-18(22)20(24)19(23)11-15/h12-20H,2-11H2,1H3.
What are the key properties of 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane?
5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane has a molecular weight of 348.47 g/mol, XLogP of 6.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-ethylcyclohexyl)-2-fluorocyclohexyl]-1,2,3-trifluorocyclohexane is sourced from PubChem (CID 88960394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).