C12H19NO2 — CID 88960491
(3R,4R,5S)-5-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine-3,4-diol (PubChem CID 88960491) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (3R,4R,5S)-5-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine-3,4-diol.
| Compound Name | (3R,4R,5S)-5-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 88960491 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (3R,4R,5S)-5-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine-3,4-diol |
| SMILES | C=C/C=C(\C=C)C[C@H]1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H19NO2/c1-3-5-9(4-2)6-10-7-13-8-11(14)12(10)15/h3-5,10-15H,1-2,6-8H2/b9-5+/t10-,11+,12+/m0/s1 |
| InChIKey | KNVGVYYPAIITNN-DEMQSYJASA-N |
| XLogP | 0.62 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|