C14H23N — CID 88960923
(6Z,8Z)-4-propylundeca-6,8,10-trien-1-imine (PubChem CID 88960923) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is (6Z,8Z)-4-propylundeca-6,8,10-trien-1-imine.
| Compound Name | (6Z,8Z)-4-propylundeca-6,8,10-trien-1-imine |
|---|---|
| PubChem CID | 88960923 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (6Z,8Z)-4-propylundeca-6,8,10-trien-1-imine |
| SMILES | [H]/N=C/CCC(C/C=C\C=C/C=C)CCC |
| InChI | InChI=1S/C14H23N/c1-3-5-6-7-8-11-14(10-4-2)12-9-13-15/h3,5-8,13-15H,1,4,9-12H2,2H3/b6-5-,8-7-,15-13+ |
| InChIKey | NSQOPSKGZZVKPI-SRNJSQTFSA-N |
| XLogP | 4.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|