C12H22N2O — CID 88960997
(3Z,5Z)-6-methoxy-5-N,2,2-trimethylocta-3,5,7-triene-3,5-diamine (PubChem CID 88960997) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (3Z,5Z)-6-methoxy-5-N,2,2-trimethylocta-3,5,7-triene-3,5-diamine.
| Compound Name | (3Z,5Z)-6-methoxy-5-N,2,2-trimethylocta-3,5,7-triene-3,5-diamine |
|---|---|
| PubChem CID | 88960997 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3Z,5Z)-6-methoxy-5-N,2,2-trimethylocta-3,5,7-triene-3,5-diamine |
| SMILES | C=C/C(OC)=C(\C=C(/N)C(C)(C)C)NC |
| InChI | InChI=1S/C12H22N2O/c1-7-10(15-6)9(14-5)8-11(13)12(2,3)4/h7-8,14H,1,13H2,2-6H3/b10-9-,11-8- |
| InChIKey | CLPGWIOZVBYSJV-QCTTUENDSA-N |
| XLogP | 2.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|