About (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol
(3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol (PubChem CID 88961692) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol |
| PubChem CID | 88961692 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol |
| SMILES | C=C/C(C)=C\C(=C/CC)CCO |
| InChI | InChI=1S/C11H18O/c1-4-6-11(7-8-12)9-10(3)5-2/h5-6,9,12H,2,4,7-8H2,1,3H3/b10-9-,11-6- |
| InChIKey | YXXWOIHOJHUFFL-JTZIFJBISA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol?
The IUPAC name of (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol (CID 88961692) is (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol.
What is the SMILES notation for (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol?
The canonical SMILES for (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol is C=C/C(C)=C\C(=C/CC)CCO.
What is the InChIKey of (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol?
The InChIKey is YXXWOIHOJHUFFL-JTZIFJBISA-N. The full InChI is InChI=1S/C11H18O/c1-4-6-11(7-8-12)9-10(3)5-2/h5-6,9,12H,2,4,7-8H2,1,3H3/b10-9-,11-6-.
What are the key properties of (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol?
(3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol has a molecular weight of 166.26 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dien-1-ol is sourced from PubChem (CID 88961692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).