C12H16F6O2 — CID 88961696
1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2-methyl-2-propan-2-ylpent-3-enoate (PubChem CID 88961696) has the molecular formula C12H16F6O2 and a molecular weight of 306.25 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2-methyl-2-propan-2-ylpent-3-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2-methyl-2-propan-2-ylpent-3-enoate |
|---|---|
| PubChem CID | 88961696 |
| Molecular Formula | C12H16F6O2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2-methyl-2-propan-2-ylpent-3-enoate |
| SMILES | C/C=C\C(C)(C(=O)OC(C(F)(F)F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H16F6O2/c1-5-6-10(4,7(2)3)9(19)20-8(11(13,14)15)12(16,17)18/h5-8H,1-4H3/b6-5- |
| InChIKey | JSVZJWPWHWJYPU-WAYWQWQTSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|