C9H13F — CID 88961713
(3Z,5E)-5-fluoro-2,3-dimethylhepta-1,3,5-triene (PubChem CID 88961713) has the molecular formula C9H13F and a molecular weight of 140.20 g/mol. Its IUPAC name is (3Z,5E)-5-fluoro-2,3-dimethylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-fluoro-2,3-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 88961713 |
| Molecular Formula | C9H13F |
| Molecular Weight | 140.20 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | (3Z,5E)-5-fluoro-2,3-dimethylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(C)=C\C(F)=C/C |
| InChI | InChI=1S/C9H13F/c1-5-9(10)6-8(4)7(2)3/h5-6H,2H2,1,3-4H3/b8-6-,9-5+ |
| InChIKey | CPZZZHYTNWMUFM-POEMVANMSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|