C13H22O — CID 88961780
(2Z,4E,6E)-4-methoxy-7,9-dimethyldeca-2,4,6-triene (PubChem CID 88961780) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (2Z,4E,6E)-4-methoxy-7,9-dimethyldeca-2,4,6-triene.
| Compound Name | (2Z,4E,6E)-4-methoxy-7,9-dimethyldeca-2,4,6-triene |
|---|---|
| PubChem CID | 88961780 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (2Z,4E,6E)-4-methoxy-7,9-dimethyldeca-2,4,6-triene |
| SMILES | C/C=C\C(=C/C=C(\C)CC(C)C)OC |
| InChI | InChI=1S/C13H22O/c1-6-7-13(14-5)9-8-12(4)10-11(2)3/h6-9,11H,10H2,1-5H3/b7-6-,12-8+,13-9+ |
| InChIKey | GYECIBRJJZHGSE-CYAJVYQESA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|