C31H34N2O2S3 — CID 88961821
(1',3',3'-trimethylspiro[4H-benzo[h]quinoline-3,2'-indole]-9-yl) 2-butylsulfanylcarbothioylsulfanylpropanoate (PubChem CID 88961821) has the molecular formula C31H34N2O2S3 and a molecular weight of 562.83 g/mol. Its IUPAC name is (1',3',3'-trimethylspiro[4H-benzo[h]quinoline-3,2'-indole]-9-yl) 2-butylsulfanylcarbothioylsulfanylpropanoate.
| Compound Name | (1',3',3'-trimethylspiro[4H-benzo[h]quinoline-3,2'-indole]-9-yl) 2-butylsulfanylcarbothioylsulfanylpropanoate |
|---|---|
| PubChem CID | 88961821 |
| Molecular Formula | C31H34N2O2S3 |
| Molecular Weight | 562.83 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (1',3',3'-trimethylspiro[4H-benzo[h]quinoline-3,2'-indole]-9-yl) 2-butylsulfanylcarbothioylsulfanylpropanoate |
| SMILES | CCCCSC(=S)SC(C)C(=O)Oc1ccc2ccc3c(c2c1)N=CC1(C3)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C31H34N2O2S3/c1-6-7-16-37-29(36)38-20(2)28(34)35-23-15-14-21-12-13-22-18-31(19-32-27(22)24(21)17-23)30(3,4)25-10-8-9-11-26(25)33(31)5/h8-15,17,19-20H,6-7,16,18H2,1-5H3 |
| InChIKey | GBRPKJZLUPOUOV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.83 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|