C18H30Cl2 — CID 88961826
(2Z,4E)-2,3-dichloro-6-(2,2-dimethylpropyl)-5-ethenyl-7,7-dimethylnona-2,4-diene (PubChem CID 88961826) has the molecular formula C18H30Cl2 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2Z,4E)-2,3-dichloro-6-(2,2-dimethylpropyl)-5-ethenyl-7,7-dimethylnona-2,4-diene.
| Compound Name | (2Z,4E)-2,3-dichloro-6-(2,2-dimethylpropyl)-5-ethenyl-7,7-dimethylnona-2,4-diene |
|---|---|
| PubChem CID | 88961826 |
| Molecular Formula | C18H30Cl2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2Z,4E)-2,3-dichloro-6-(2,2-dimethylpropyl)-5-ethenyl-7,7-dimethylnona-2,4-diene |
| SMILES | C=C/C(=C\C(Cl)=C(/C)Cl)C(CC(C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C18H30Cl2/c1-9-14(11-16(20)13(3)19)15(12-17(4,5)6)18(7,8)10-2/h9,11,15H,1,10,12H2,2-8H3/b14-11+,16-13- |
| InChIKey | MOFBVYZWCGSRFQ-YLJYFMQQSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|