C14H6F5NO5S — CID 88962172
isoindole-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid (PubChem CID 88962172) has the molecular formula C14H6F5NO5S and a molecular weight of 395.26 g/mol. Its IUPAC name is isoindole-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid.
| Compound Name | isoindole-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 88962172 |
| Molecular Formula | C14H6F5NO5S |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | isoindole-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid |
| SMILES | O=C1NC(=O)c2ccccc21.O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5NO2.C6HF5O3S/c10-7-5-3-1-2-4-6(5)8(11)9-7;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h1-4H,(H,9,10,11);(H,12,13,14) |
| InChIKey | LDTHGGSAQGHLKC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|