About chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane
chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane (PubChem CID 88962238) has the molecular formula C24H27ClSi
and a molecular weight of 379.02 g/mol. Its IUPAC name is chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane.
Molecular Properties
| Compound Name | chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane |
| PubChem CID | 88962238 |
| Molecular Formula | C24H27ClSi |
| Molecular Weight | 379.02 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane |
| SMILES | Cc1cc(C)cc([Si](Cl)(c2cccc(C)c2C)c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C24H27ClSi/c1-16-13-17(2)15-22(14-16)26(25,23-11-7-9-18(3)20(23)5)24-12-8-10-19(4)21(24)6/h7-15H,1-6H3 |
| InChIKey | INIBQSJGYAGZAF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.02 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane?
The IUPAC name of chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane (CID 88962238) is chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane.
What is the SMILES notation for chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane?
The canonical SMILES for chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane is Cc1cc(C)cc([Si](Cl)(c2cccc(C)c2C)c2cccc(C)c2C)c1.
What is the InChIKey of chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane?
The InChIKey is INIBQSJGYAGZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27ClSi/c1-16-13-17(2)15-22(14-16)26(25,23-11-7-9-18(3)20(23)5)24-12-8-10-19(4)21(24)6/h7-15H,1-6H3.
What are the key properties of chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane?
chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane has a molecular weight of 379.02 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-bis(2,3-dimethylphenyl)-(3,5-dimethylphenyl)silane is sourced from PubChem (CID 88962238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).