About 5-butylnonan-5-amine;phosphoric acid
5-butylnonan-5-amine;phosphoric acid (PubChem CID 88962478) has the molecular formula C13H32NO4P
and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-butylnonan-5-amine;phosphoric acid.
Molecular Properties
| Compound Name | 5-butylnonan-5-amine;phosphoric acid |
| PubChem CID | 88962478 |
| Molecular Formula | C13H32NO4P |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 5-butylnonan-5-amine;phosphoric acid |
| SMILES | CCCCC(N)(CCCC)CCCC.O=P(O)(O)O |
| InChI | InChI=1S/C13H29N.H3O4P/c1-4-7-10-13(14,11-8-5-2)12-9-6-3;1-5(2,3)4/h4-12,14H2,1-3H3;(H3,1,2,3,4) |
| InChIKey | KHMMQRKSWMNCGI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-butylnonan-5-amine;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-amine;phosphoric acid?
The IUPAC name of 5-butylnonan-5-amine;phosphoric acid (CID 88962478) is 5-butylnonan-5-amine;phosphoric acid.
What is the SMILES notation for 5-butylnonan-5-amine;phosphoric acid?
The canonical SMILES for 5-butylnonan-5-amine;phosphoric acid is CCCCC(N)(CCCC)CCCC.O=P(O)(O)O.
What is the InChIKey of 5-butylnonan-5-amine;phosphoric acid?
The InChIKey is KHMMQRKSWMNCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N.H3O4P/c1-4-7-10-13(14,11-8-5-2)12-9-6-3;1-5(2,3)4/h4-12,14H2,1-3H3;(H3,1,2,3,4).
What are the key properties of 5-butylnonan-5-amine;phosphoric acid?
5-butylnonan-5-amine;phosphoric acid has a molecular weight of 297.38 g/mol, XLogP of 3.33, 9 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-amine;phosphoric acid is sourced from PubChem (CID 88962478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).