About tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane
tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane (PubChem CID 88962541) has the molecular formula C45H45ClSi
and a molecular weight of 649.39 g/mol. Its IUPAC name is tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane.
Molecular Properties
| Compound Name | tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane |
| PubChem CID | 88962541 |
| Molecular Formula | C45H45ClSi |
| Molecular Weight | 649.39 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane |
| SMILES | Cc1ccc([Si](Cl)(c2ccc(C)c(C)c2Cc2ccccc2)c2ccc(C)c(C)c2Cc2ccccc2)c(Cc2ccccc2)c1C |
| InChI | InChI=1S/C45H45ClSi/c1-31-22-25-43(40(34(31)4)28-37-16-10-7-11-17-37)47(46,44-26-23-32(2)35(5)41(44)29-38-18-12-8-13-19-38)45-27-24-33(3)36(6)42(45)30-39-20-14-9-15-21-39/h7-27H,28-30H2,1-6H3 |
| InChIKey | KPXMZFIMZDIXDG-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 649.39 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane?
The IUPAC name of tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane (CID 88962541) is tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane.
What is the SMILES notation for tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane?
The canonical SMILES for tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane is Cc1ccc([Si](Cl)(c2ccc(C)c(C)c2Cc2ccccc2)c2ccc(C)c(C)c2Cc2ccccc2)c(Cc2ccccc2)c1C.
What is the InChIKey of tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane?
The InChIKey is KPXMZFIMZDIXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H45ClSi/c1-31-22-25-43(40(34(31)4)28-37-16-10-7-11-17-37)47(46,44-26-23-32(2)35(5)41(44)29-38-18-12-8-13-19-38)45-27-24-33(3)36(6)42(45)30-39-20-14-9-15-21-39/h7-27H,28-30H2,1-6H3.
What are the key properties of tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane?
tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane has a molecular weight of 649.39 g/mol, XLogP of 9.52, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-benzyl-3,4-dimethylphenyl)-chlorosilane is sourced from PubChem (CID 88962541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).