C48H43F3Si — CID 88962567
tris(3-benzyl-5-fluorophenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 88962567) has the molecular formula C48H43F3Si and a molecular weight of 704.95 g/mol. Its IUPAC name is tris(3-benzyl-5-fluorophenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(3-benzyl-5-fluorophenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 88962567 |
| Molecular Formula | C48H43F3Si |
| Molecular Weight | 704.95 g/mol |
| Exact Mass | 704.31 |
| IUPAC Name | tris(3-benzyl-5-fluorophenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2cc(F)cc(Cc3ccccc3)c2)(c2cc(F)cc(Cc3ccccc3)c2)c2cc(F)cc(Cc3ccccc3)c2)=C1C |
| InChI | InChI=1S/C48H43F3Si/c1-32-33(2)35(4)48(34(32)3)52(45-26-39(23-42(49)29-45)20-36-14-8-5-9-15-36,46-27-40(24-43(50)30-46)21-37-16-10-6-11-17-37)47-28-41(25-44(51)31-47)22-38-18-12-7-13-19-38/h5-19,23-31,34H,20-22H2,1-4H3 |
| InChIKey | BEPGIVVTCYNHKR-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.95 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|