C51H57ClSi — CID 88962612
chloro-tris[4-(2,3,4,5,6-pentamethylphenyl)phenyl]silane (PubChem CID 88962612) has the molecular formula C51H57ClSi and a molecular weight of 733.56 g/mol. Its IUPAC name is chloro-tris[4-(2,3,4,5,6-pentamethylphenyl)phenyl]silane.
| Compound Name | chloro-tris[4-(2,3,4,5,6-pentamethylphenyl)phenyl]silane |
|---|---|
| PubChem CID | 88962612 |
| Molecular Formula | C51H57ClSi |
| Molecular Weight | 733.56 g/mol |
| Exact Mass | 732.39 |
| IUPAC Name | chloro-tris[4-(2,3,4,5,6-pentamethylphenyl)phenyl]silane |
| SMILES | Cc1c(C)c(C)c(-c2ccc([Si](Cl)(c3ccc(-c4c(C)c(C)c(C)c(C)c4C)cc3)c3ccc(-c4c(C)c(C)c(C)c(C)c4C)cc3)cc2)c(C)c1C |
| InChI | InChI=1S/C51H57ClSi/c1-28-31(4)37(10)49(38(11)32(28)5)43-16-22-46(23-17-43)53(52,47-24-18-44(19-25-47)50-39(12)33(6)29(2)34(7)40(50)13)48-26-20-45(21-27-48)51-41(14)35(8)30(3)36(9)42(51)15/h16-27H,1-15H3 |
| InChIKey | NRMCFZLDFSJRND-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.56 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|