C33H51ClN6Si — CID 88962662
2-[bis[2,5-bis(dimethylamino)-3-methylphenyl]-chlorosilyl]-1-N,1-N,4-N,4-N,6-pentamethylbenzene-1,4-diamine (PubChem CID 88962662) has the molecular formula C33H51ClN6Si and a molecular weight of 595.35 g/mol. Its IUPAC name is 2-[bis[2,5-bis(dimethylamino)-3-methylphenyl]-chlorosilyl]-1-N,1-N,4-N,4-N,6-pentamethylbenzene-1,4-diamine.
| Compound Name | 2-[bis[2,5-bis(dimethylamino)-3-methylphenyl]-chlorosilyl]-1-N,1-N,4-N,4-N,6-pentamethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 88962662 |
| Molecular Formula | C33H51ClN6Si |
| Molecular Weight | 595.35 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | 2-[bis[2,5-bis(dimethylamino)-3-methylphenyl]-chlorosilyl]-1-N,1-N,4-N,4-N,6-pentamethylbenzene-1,4-diamine |
| SMILES | Cc1cc(N(C)C)cc([Si](Cl)(c2cc(N(C)C)cc(C)c2N(C)C)c2cc(N(C)C)cc(C)c2N(C)C)c1N(C)C |
| InChI | InChI=1S/C33H51ClN6Si/c1-22-16-25(35(4)5)19-28(31(22)38(10)11)41(34,29-20-26(36(6)7)17-23(2)32(29)39(12)13)30-21-27(37(8)9)18-24(3)33(30)40(14)15/h16-21H,1-15H3 |
| InChIKey | ZGXUHPDVTDXROW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|