About chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane
chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane (PubChem CID 88962825) has the molecular formula C26H35ClSi3
and a molecular weight of 467.28 g/mol. Its IUPAC name is chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane.
Molecular Properties
| Compound Name | chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane |
| PubChem CID | 88962825 |
| Molecular Formula | C26H35ClSi3 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane |
| SMILES | Cc1cc(C)cc([Si](Cl)(c2cccc([Si](C)(C)C)c2)c2cccc([Si](C)(C)C)c2)c1 |
| InChI | InChI=1S/C26H35ClSi3/c1-20-15-21(2)17-26(16-20)30(27,24-13-9-11-22(18-24)28(3,4)5)25-14-10-12-23(19-25)29(6,7)8/h9-19H,1-8H3 |
| InChIKey | MWMAAJLPZFJYQJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane?
The IUPAC name of chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane (CID 88962825) is chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane.
What is the SMILES notation for chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane?
The canonical SMILES for chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane is Cc1cc(C)cc([Si](Cl)(c2cccc([Si](C)(C)C)c2)c2cccc([Si](C)(C)C)c2)c1.
What is the InChIKey of chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane?
The InChIKey is MWMAAJLPZFJYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35ClSi3/c1-20-15-21(2)17-26(16-20)30(27,24-13-9-11-22(18-24)28(3,4)5)25-14-10-12-23(19-25)29(6,7)8/h9-19H,1-8H3.
What are the key properties of chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane?
chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane has a molecular weight of 467.28 g/mol, XLogP of 4.60, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(3,5-dimethylphenyl)-bis(3-trimethylsilylphenyl)silane is sourced from PubChem (CID 88962825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).