About chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane
chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane (PubChem CID 88962958) has the molecular formula C28H34ClFSi
and a molecular weight of 453.12 g/mol. Its IUPAC name is chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane.
Molecular Properties
| Compound Name | chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane |
| PubChem CID | 88962958 |
| Molecular Formula | C28H34ClFSi |
| Molecular Weight | 453.12 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane |
| SMILES | Cc1cc(C)cc([Si](Cl)(c2ccc(F)cc2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C28H34ClFSi/c1-19-13-20(2)15-25(14-19)31(29,24-11-9-23(30)10-12-24)26-17-21(27(3,4)5)16-22(18-26)28(6,7)8/h9-18H,1-8H3 |
| InChIKey | YIKXWXNQKCRPDG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.12 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane?
The IUPAC name of chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane (CID 88962958) is chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane.
What is the SMILES notation for chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane?
The canonical SMILES for chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane is Cc1cc(C)cc([Si](Cl)(c2ccc(F)cc2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1.
What is the InChIKey of chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane?
The InChIKey is YIKXWXNQKCRPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34ClFSi/c1-19-13-20(2)15-25(14-19)31(29,24-11-9-23(30)10-12-24)26-17-21(27(3,4)5)16-22(18-26)28(6,7)8/h9-18H,1-8H3.
What are the key properties of chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane?
chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane has a molecular weight of 453.12 g/mol, XLogP of 6.24, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(3,5-ditert-butylphenyl)-(3,5-dimethylphenyl)-(4-fluorophenyl)silane is sourced from PubChem (CID 88962958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).