About chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane
chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane (PubChem CID 88963048) has the molecular formula C33H51ClSi4
and a molecular weight of 595.57 g/mol. Its IUPAC name is chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane.
Molecular Properties
| Compound Name | chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane |
| PubChem CID | 88963048 |
| Molecular Formula | C33H51ClSi4 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane |
| SMILES | Cc1cc([Si](Cl)(c2cc(C)c([Si](C)(C)C)cc2C)c2cc(C)c([Si](C)(C)C)cc2C)c(C)cc1[Si](C)(C)C |
| InChI | InChI=1S/C33H51ClSi4/c1-22-19-31(25(4)16-28(22)35(7,8)9)38(34,32-20-23(2)29(17-26(32)5)36(10,11)12)33-21-24(3)30(18-27(33)6)37(13,14)15/h16-21H,1-15H3 |
| InChIKey | LNHBSHABKGAHPY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane?
The IUPAC name of chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane (CID 88963048) is chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane.
What is the SMILES notation for chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane?
The canonical SMILES for chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane is Cc1cc([Si](Cl)(c2cc(C)c([Si](C)(C)C)cc2C)c2cc(C)c([Si](C)(C)C)cc2C)c(C)cc1[Si](C)(C)C.
What is the InChIKey of chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane?
The InChIKey is LNHBSHABKGAHPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H51ClSi4/c1-22-19-31(25(4)16-28(22)35(7,8)9)38(34,32-20-23(2)29(17-26(32)5)36(10,11)12)33-21-24(3)30(18-27(33)6)37(13,14)15/h16-21H,1-15H3.
What are the key properties of chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane?
chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane has a molecular weight of 595.57 g/mol, XLogP of 6.38, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-tris(2,5-dimethyl-4-trimethylsilylphenyl)silane is sourced from PubChem (CID 88963048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).