C36H46O6Si — CID 88963068
tris(2,6-dimethoxy-4-methylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 88963068) has the molecular formula C36H46O6Si and a molecular weight of 602.84 g/mol. Its IUPAC name is tris(2,6-dimethoxy-4-methylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(2,6-dimethoxy-4-methylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 88963068 |
| Molecular Formula | C36H46O6Si |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | tris(2,6-dimethoxy-4-methylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | COc1cc(C)cc(OC)c1[Si](C1=C(C)C(C)=C(C)C1C)(c1c(OC)cc(C)cc1OC)c1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C36H46O6Si/c1-20-14-27(37-8)34(28(15-20)38-9)43(33-25(6)23(4)24(5)26(33)7,35-29(39-10)16-21(2)17-30(35)40-11)36-31(41-12)18-22(3)19-32(36)42-13/h14-19,25H,1-13H3 |
| InChIKey | VPGFVDUPECVVCO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|