C10H14F3N — CID 88963377
(2Z,4Z)-5-ethenyl-1,1,1-trifluoroocta-2,4-dien-2-amine (PubChem CID 88963377) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (2Z,4Z)-5-ethenyl-1,1,1-trifluoroocta-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-5-ethenyl-1,1,1-trifluoroocta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 88963377 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2Z,4Z)-5-ethenyl-1,1,1-trifluoroocta-2,4-dien-2-amine |
| SMILES | C=C/C(=C\C=C(/N)C(F)(F)F)CCC |
| InChI | InChI=1S/C10H14F3N/c1-3-5-8(4-2)6-7-9(14)10(11,12)13/h4,6-7H,2-3,5,14H2,1H3/b8-6+,9-7- |
| InChIKey | AAGANSIJDBUMPD-FFELTBSMSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|