C10H18N2 — CID 88963383
(1Z,3Z)-2-methyl-5-N-propan-2-ylhexa-1,3,5-triene-1,5-diamine (PubChem CID 88963383) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (1Z,3Z)-2-methyl-5-N-propan-2-ylhexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3Z)-2-methyl-5-N-propan-2-ylhexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 88963383 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (1Z,3Z)-2-methyl-5-N-propan-2-ylhexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(/C=C\C(C)=C/N)NC(C)C |
| InChI | InChI=1S/C10H18N2/c1-8(2)12-10(4)6-5-9(3)7-11/h5-8,12H,4,11H2,1-3H3/b6-5-,9-7- |
| InChIKey | UEKOFCDLFKDFGV-LZWBOMALSA-N |
| XLogP | 1.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|