About (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide
(Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide (PubChem CID 88963468) has the molecular formula C11H9F2IN2
and a molecular weight of 334.11 g/mol. Its IUPAC name is (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide.
Molecular Properties
| Compound Name | (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide |
| PubChem CID | 88963468 |
| Molecular Formula | C11H9F2IN2 |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide |
| SMILES | C=C/N=C(I)/C=C(\N)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H9F2IN2/c1-2-16-11(14)6-10(15)8-4-3-7(12)5-9(8)13/h2-6H,1,15H2/b10-6-,16-11- |
| InChIKey | WZJPUZXPQANEGT-VDJHTXBNSA-N |
| XLogP | 3.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide?
The IUPAC name of (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide (CID 88963468) is (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide.
What is the SMILES notation for (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide?
The canonical SMILES for (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide is C=C/N=C(I)/C=C(\N)c1ccc(F)cc1F.
What is the InChIKey of (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide?
The InChIKey is WZJPUZXPQANEGT-VDJHTXBNSA-N. The full InChI is InChI=1S/C11H9F2IN2/c1-2-16-11(14)6-10(15)8-4-3-7(12)5-9(8)13/h2-6H,1,15H2/b10-6-,16-11-.
What are the key properties of (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide?
(Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide has a molecular weight of 334.11 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-3-(2,4-difluorophenyl)-N-ethenylprop-2-enimidoyl iodide is sourced from PubChem (CID 88963468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).