C18H34O4 — CID 88963494
2,3-dihydroxypropyl (E)-6,8-dimethyltridec-5-enoate (PubChem CID 88963494) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (E)-6,8-dimethyltridec-5-enoate.
| Compound Name | 2,3-dihydroxypropyl (E)-6,8-dimethyltridec-5-enoate |
|---|---|
| PubChem CID | 88963494 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2,3-dihydroxypropyl (E)-6,8-dimethyltridec-5-enoate |
| SMILES | CCCCCC(C)C/C(C)=C/CCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C18H34O4/c1-4-5-6-9-15(2)12-16(3)10-7-8-11-18(21)22-14-17(20)13-19/h10,15,17,19-20H,4-9,11-14H2,1-3H3/b16-10+ |
| InChIKey | UVLWJAFJXWYEGV-MHWRWJLKSA-N |
| XLogP | 3.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|