C39H66ClN9Si — CID 88963789
5-[chloro-bis[2,4,5-tris(dimethylamino)-3-methylphenyl]silyl]-1-N,1-N,2-N,2-N,4-N,4-N,3-heptamethylbenzene-1,2,4-triamine (PubChem CID 88963789) has the molecular formula C39H66ClN9Si and a molecular weight of 724.56 g/mol. Its IUPAC name is 5-[chloro-bis[2,4,5-tris(dimethylamino)-3-methylphenyl]silyl]-1-N,1-N,2-N,2-N,4-N,4-N,3-heptamethylbenzene-1,2,4-triamine.
| Compound Name | 5-[chloro-bis[2,4,5-tris(dimethylamino)-3-methylphenyl]silyl]-1-N,1-N,2-N,2-N,4-N,4-N,3-heptamethylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 88963789 |
| Molecular Formula | C39H66ClN9Si |
| Molecular Weight | 724.56 g/mol |
| Exact Mass | 723.49 |
| IUPAC Name | 5-[chloro-bis[2,4,5-tris(dimethylamino)-3-methylphenyl]silyl]-1-N,1-N,2-N,2-N,4-N,4-N,3-heptamethylbenzene-1,2,4-triamine |
| SMILES | Cc1c(N(C)C)c(N(C)C)cc([Si](Cl)(c2cc(N(C)C)c(N(C)C)c(C)c2N(C)C)c2cc(N(C)C)c(N(C)C)c(C)c2N(C)C)c1N(C)C |
| InChI | InChI=1S/C39H66ClN9Si/c1-25-34(44(10)11)28(41(4)5)22-31(37(25)47(16)17)50(40,32-23-29(42(6)7)35(45(12)13)26(2)38(32)48(18)19)33-24-30(43(8)9)36(46(14)15)27(3)39(33)49(20)21/h22-24H,1-21H3 |
| InChIKey | YBRGCKCKMFSEBX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|