C25H50N8O5 — CID 88964294
N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide (PubChem CID 88964294) has the molecular formula C25H50N8O5 and a molecular weight of 542.73 g/mol. Its IUPAC name is N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide.
| Compound Name | N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 88964294 |
| Molecular Formula | C25H50N8O5 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.39 |
| IUPAC Name | N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-N'-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]pentanediamide |
| SMILES | CN[C@@H](CCCCNC(=O)CCCC(=O)NC(CNC(C)(C)/C(C)=N/O)CNC(C)(C)/C(C)=N/O)C(N)=O |
| InChI | InChI=1S/C25H50N8O5/c1-17(32-37)24(3,4)29-15-19(16-30-25(5,6)18(2)33-38)31-22(35)13-10-12-21(34)28-14-9-8-11-20(27-7)23(26)36/h19-20,27,29-30,37-38H,8-16H2,1-7H3,(H2,26,36)(H,28,34)(H,31,35)/b32-17+,33-18+/t20-/m0/s1 |
| InChIKey | LDYHKVOTAPQGCY-XTMCUOALSA-N |
| XLogP | 0.44 |
| TPSA | 202.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|