C14H20N2O — CID 88964566
(3E,4Z,7Z,9Z)-5,10-diamino-3-ethylidene-8-methyl-6-methylidenedeca-1,4,7,9-tetraen-2-ol (PubChem CID 88964566) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (3E,4Z,7Z,9Z)-5,10-diamino-3-ethylidene-8-methyl-6-methylidenedeca-1,4,7,9-tetraen-2-ol.
| Compound Name | (3E,4Z,7Z,9Z)-5,10-diamino-3-ethylidene-8-methyl-6-methylidenedeca-1,4,7,9-tetraen-2-ol |
|---|---|
| PubChem CID | 88964566 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (3E,4Z,7Z,9Z)-5,10-diamino-3-ethylidene-8-methyl-6-methylidenedeca-1,4,7,9-tetraen-2-ol |
| SMILES | C=C(/C=C(C)\C=C/N)/C(N)=C/C(=C\C)C(=C)O |
| InChI | InChI=1S/C14H20N2O/c1-5-13(12(4)17)9-14(16)11(3)8-10(2)6-7-15/h5-9,17H,3-4,15-16H2,1-2H3/b7-6-,10-8-,13-5+,14-9- |
| InChIKey | MTVIBXINESLMNR-TVFIUMLFSA-N |
| XLogP | 2.82 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|