C16H23N — CID 88964630
(3E,4E,7Z,9Z)-3-ethylidene-5,8-dimethyl-6-methylideneundeca-1,4,7,9-tetraen-2-amine (PubChem CID 88964630) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (3E,4E,7Z,9Z)-3-ethylidene-5,8-dimethyl-6-methylideneundeca-1,4,7,9-tetraen-2-amine.
| Compound Name | (3E,4E,7Z,9Z)-3-ethylidene-5,8-dimethyl-6-methylideneundeca-1,4,7,9-tetraen-2-amine |
|---|---|
| PubChem CID | 88964630 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (3E,4E,7Z,9Z)-3-ethylidene-5,8-dimethyl-6-methylideneundeca-1,4,7,9-tetraen-2-amine |
| SMILES | C=C(/C=C(C)\C=C/C)/C(C)=C/C(=C\C)C(=C)N |
| InChI | InChI=1S/C16H23N/c1-7-9-12(3)10-13(4)14(5)11-16(8-2)15(6)17/h7-11H,4,6,17H2,1-3,5H3/b9-7-,12-10-,14-11+,16-8+ |
| InChIKey | XZYRIVVRFNWVML-XLOWYXTESA-N |
| XLogP | 4.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|