C17H25NO4S — CID 88964639
2-[[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]amino]benzenesulfonic acid (PubChem CID 88964639) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]amino]benzenesulfonic acid.
| Compound Name | 2-[[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 88964639 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]amino]benzenesulfonic acid |
| SMILES | CC(C)(C)CC1(C(=O)Nc2ccccc2S(=O)(=O)O)CC1(C)C |
| InChI | InChI=1S/C17H25NO4S/c1-15(2,3)10-17(11-16(17,4)5)14(19)18-12-8-6-7-9-13(12)23(20,21)22/h6-9H,10-11H2,1-5H3,(H,18,19)(H,20,21,22) |
| InChIKey | VPBXPMJUOFMGHH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|