C10H16N2 — CID 88964772
methyl-[(3Z,6Z)-5-methylocta-1,3,6-trien-2-yl]diazene (PubChem CID 88964772) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is methyl-[(3Z,6Z)-5-methylocta-1,3,6-trien-2-yl]diazene.
| Compound Name | methyl-[(3Z,6Z)-5-methylocta-1,3,6-trien-2-yl]diazene |
|---|---|
| PubChem CID | 88964772 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | methyl-[(3Z,6Z)-5-methylocta-1,3,6-trien-2-yl]diazene |
| SMILES | C=C(/C=C\C(C)/C=C\C)/N=N/C |
| InChI | InChI=1S/C10H16N2/c1-5-6-9(2)7-8-10(3)12-11-4/h5-9H,3H2,1-2,4H3/b6-5-,8-7-,12-11+ |
| InChIKey | GIARDMDMTTZULD-KUTMVHEYSA-N |
| XLogP | 3.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|