C19H25NO — CID 88964799
(2E)-N-[(3Z)-4-ethyl-3-[(E)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide (PubChem CID 88964799) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (2E)-N-[(3Z)-4-ethyl-3-[(E)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-[(3Z)-4-ethyl-3-[(E)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 88964799 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (2E)-N-[(3Z)-4-ethyl-3-[(E)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C/C)C(=O)NC(=C)C(/C=C/C)=C(\C=C)CC |
| InChI | InChI=1S/C19H25NO/c1-7-12-17(13-8-2)19(21)20-15(6)18(14-9-3)16(10-4)11-5/h7-10,12-14H,1,4,6,11H2,2-3,5H3,(H,20,21)/b13-8-,14-9+,17-12+,18-16+ |
| InChIKey | DQXHKUWZAPLHAM-SDDLHBJQSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|