C10H12BrN3O — CID 88964856
(1E,3Z)-2-bromo-3-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)hexa-1,3,5-trien-1-amine (PubChem CID 88964856) has the molecular formula C10H12BrN3O and a molecular weight of 270.13 g/mol. Its IUPAC name is (1E,3Z)-2-bromo-3-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-2-bromo-3-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88964856 |
| Molecular Formula | C10H12BrN3O |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | (1E,3Z)-2-bromo-3-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C(C)\C(Br)=C/N)c1nnc(C)o1 |
| InChI | InChI=1S/C10H12BrN3O/c1-6(9(11)5-12)4-7(2)10-14-13-8(3)15-10/h4-5H,2,12H2,1,3H3/b6-4-,9-5+ |
| InChIKey | ASKOOFQSBIBQKM-QUNSIMLLSA-N |
| XLogP | 2.53 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|