C15H14F18O5S2 — CID 88964880
2-[2,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethyl]pentan-1-ol (PubChem CID 88964880) has the molecular formula C15H14F18O5S2 and a molecular weight of 680.37 g/mol. Its IUPAC name is 2-[2,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethyl]pentan-1-ol.
| Compound Name | 2-[2,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethyl]pentan-1-ol |
|---|---|
| PubChem CID | 88964880 |
| Molecular Formula | C15H14F18O5S2 |
| Molecular Weight | 680.37 g/mol |
| Exact Mass | 680.00 |
| IUPAC Name | 2-[2,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethyl]pentan-1-ol |
| SMILES | CCCC(CO)CC(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F18O5S2/c1-2-3-6(5-34)4-7(39(35,36)14(30,31)10(20,21)8(16,17)12(24,25)26)40(37,38)15(32,33)11(22,23)9(18,19)13(27,28)29/h6-7,34H,2-5H2,1H3 |
| InChIKey | VRQYCRRWCAGXQC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|