C14H12F18O5S2 — CID 88964887
4-methyl-1,1-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pentan-3-ol (PubChem CID 88964887) has the molecular formula C14H12F18O5S2 and a molecular weight of 666.34 g/mol. Its IUPAC name is 4-methyl-1,1-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pentan-3-ol.
| Compound Name | 4-methyl-1,1-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pentan-3-ol |
|---|---|
| PubChem CID | 88964887 |
| Molecular Formula | C14H12F18O5S2 |
| Molecular Weight | 666.34 g/mol |
| Exact Mass | 665.98 |
| IUPAC Name | 4-methyl-1,1-bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pentan-3-ol |
| SMILES | CC(C)C(O)CC(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F18O5S2/c1-4(2)5(33)3-6(38(34,35)13(29,30)9(19,20)7(15,16)11(23,24)25)39(36,37)14(31,32)10(21,22)8(17,18)12(26,27)28/h4-6,33H,3H2,1-2H3 |
| InChIKey | SHHKEJNGLSQNKN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|