C8H8F10O5S2 — CID 88964962
4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butan-2-ol (PubChem CID 88964962) has the molecular formula C8H8F10O5S2 and a molecular weight of 438.26 g/mol. Its IUPAC name is 4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butan-2-ol.
| Compound Name | 4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butan-2-ol |
|---|---|
| PubChem CID | 88964962 |
| Molecular Formula | C8H8F10O5S2 |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butan-2-ol |
| SMILES | CC(O)CC(S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F10O5S2/c1-3(19)2-4(24(20,21)7(15,16)5(9,10)11)25(22,23)8(17,18)6(12,13)14/h3-4,19H,2H2,1H3 |
| InChIKey | YVVKKIXKQUVLKW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|