C10H12F10O5S2 — CID 88964965
4-methyl-1,1-bis(1,1,2,2,2-pentafluoroethylsulfonyl)pentan-3-ol (PubChem CID 88964965) has the molecular formula C10H12F10O5S2 and a molecular weight of 466.32 g/mol. Its IUPAC name is 4-methyl-1,1-bis(1,1,2,2,2-pentafluoroethylsulfonyl)pentan-3-ol.
| Compound Name | 4-methyl-1,1-bis(1,1,2,2,2-pentafluoroethylsulfonyl)pentan-3-ol |
|---|---|
| PubChem CID | 88964965 |
| Molecular Formula | C10H12F10O5S2 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 4-methyl-1,1-bis(1,1,2,2,2-pentafluoroethylsulfonyl)pentan-3-ol |
| SMILES | CC(C)C(O)CC(S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F10O5S2/c1-4(2)5(21)3-6(26(22,23)9(17,18)7(11,12)13)27(24,25)10(19,20)8(14,15)16/h4-6,21H,3H2,1-2H3 |
| InChIKey | SYECSCMRKFFDBC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|