C11H14F10O5S2 — CID 88964968
2-[2,2-bis(1,1,2,2,2-pentafluoroethylsulfonyl)ethyl]pentan-1-ol (PubChem CID 88964968) has the molecular formula C11H14F10O5S2 and a molecular weight of 480.34 g/mol. Its IUPAC name is 2-[2,2-bis(1,1,2,2,2-pentafluoroethylsulfonyl)ethyl]pentan-1-ol.
| Compound Name | 2-[2,2-bis(1,1,2,2,2-pentafluoroethylsulfonyl)ethyl]pentan-1-ol |
|---|---|
| PubChem CID | 88964968 |
| Molecular Formula | C11H14F10O5S2 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | 2-[2,2-bis(1,1,2,2,2-pentafluoroethylsulfonyl)ethyl]pentan-1-ol |
| SMILES | CCCC(CO)CC(S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F10O5S2/c1-2-3-6(5-22)4-7(27(23,24)10(18,19)8(12,13)14)28(25,26)11(20,21)9(15,16)17/h6-7,22H,2-5H2,1H3 |
| InChIKey | MXVXGWYIQQNPOW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|