C12H19F8NO4 — CID 88965019
1-[bis(2-hydroxyethyl)amino]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol (PubChem CID 88965019) has the molecular formula C12H19F8NO4 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol |
|---|---|
| PubChem CID | 88965019 |
| Molecular Formula | C12H19F8NO4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol |
| SMILES | OCCN(CCO)CC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H19F8NO4/c13-9(14)11(17,18)12(19,20)10(15,16)7-25-6-8(24)5-21(1-3-22)2-4-23/h8-9,22-24H,1-7H2 |
| InChIKey | KTMZJTVGHBMBCZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|