About 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate
1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate (PubChem CID 88965034) has the molecular formula C20H40O5Si
and a molecular weight of 388.62 g/mol. Its IUPAC name is 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate.
Molecular Properties
| Compound Name | 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate |
| PubChem CID | 88965034 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate |
| SMILES | CCCCOC(=O)C(CCC(C)C)(CC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H40O5Si/c1-8-12-15-24-19(22)20(14-13-17(5)6,16-18(21)23-7)25-26(9-2,10-3)11-4/h17H,8-16H2,1-7H3 |
| InChIKey | QSDHSDDIVFBVQU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate?
The IUPAC name of 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate (CID 88965034) is 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate.
What is the SMILES notation for 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate?
The canonical SMILES for 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate is CCCCOC(=O)C(CCC(C)C)(CC(=O)OC)O[Si](CC)(CC)CC.
What is the InChIKey of 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate?
The InChIKey is QSDHSDDIVFBVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O5Si/c1-8-12-15-24-19(22)20(14-13-17(5)6,16-18(21)23-7)25-26(9-2,10-3)11-4/h17H,8-16H2,1-7H3.
What are the key properties of 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate?
1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate has a molecular weight of 388.62 g/mol, XLogP of 5.09, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-butyl 4-O-methyl 2-(3-methylbutyl)-2-triethylsilyloxybutanedioate is sourced from PubChem (CID 88965034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).