C26H50N4 — CID 88965156
4-N-[4-(3-aminopropylamino)butyl]-2-N,2-N,2-trimethyl-3,3,4-tris(prop-2-enyl)hept-6-ene-2,4-diamine (PubChem CID 88965156) has the molecular formula C26H50N4 and a molecular weight of 418.71 g/mol. Its IUPAC name is 4-N-[4-(3-aminopropylamino)butyl]-2-N,2-N,2-trimethyl-3,3,4-tris(prop-2-enyl)hept-6-ene-2,4-diamine.
| Compound Name | 4-N-[4-(3-aminopropylamino)butyl]-2-N,2-N,2-trimethyl-3,3,4-tris(prop-2-enyl)hept-6-ene-2,4-diamine |
|---|---|
| PubChem CID | 88965156 |
| Molecular Formula | C26H50N4 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.40 |
| IUPAC Name | 4-N-[4-(3-aminopropylamino)butyl]-2-N,2-N,2-trimethyl-3,3,4-tris(prop-2-enyl)hept-6-ene-2,4-diamine |
| SMILES | C=CCC(CC=C)(NCCCCNCCCN)C(CC=C)(CC=C)C(C)(C)N(C)C |
| InChI | InChI=1S/C26H50N4/c1-9-16-25(17-10-2,24(5,6)30(7)8)26(18-11-3,19-12-4)29-23-14-13-21-28-22-15-20-27/h9-12,28-29H,1-4,13-23,27H2,5-8H3 |
| InChIKey | DSZUQUOVHYAISM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|