C18H22N4O3 — CID 88965205
benzyl (3S)-3-[(5-formyl-1H-pyrazol-3-yl)-methylamino]piperidine-1-carboxylate (PubChem CID 88965205) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is benzyl (3S)-3-[(5-formyl-1H-pyrazol-3-yl)-methylamino]piperidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[(5-formyl-1H-pyrazol-3-yl)-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88965205 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | benzyl (3S)-3-[(5-formyl-1H-pyrazol-3-yl)-methylamino]piperidine-1-carboxylate |
| SMILES | CN(c1cc(C=O)[nH]n1)[C@H]1CCCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C18H22N4O3/c1-21(17-10-15(12-23)19-20-17)16-8-5-9-22(11-16)18(24)25-13-14-6-3-2-4-7-14/h2-4,6-7,10,12,16H,5,8-9,11,13H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | FODNCVLWQNDICV-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|