C21H42O2Si2 — CID 88965288
tert-butyl-[(4R,5R,6R)-6-ethenyl-8-[hydroxy(dimethyl)silyl]-5,8-dimethylnon-1-yn-4-yl]oxy-dimethylsilane (PubChem CID 88965288) has the molecular formula C21H42O2Si2 and a molecular weight of 382.74 g/mol. Its IUPAC name is tert-butyl-[(4R,5R,6R)-6-ethenyl-8-[hydroxy(dimethyl)silyl]-5,8-dimethylnon-1-yn-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4R,5R,6R)-6-ethenyl-8-[hydroxy(dimethyl)silyl]-5,8-dimethylnon-1-yn-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 88965288 |
| Molecular Formula | C21H42O2Si2 |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | tert-butyl-[(4R,5R,6R)-6-ethenyl-8-[hydroxy(dimethyl)silyl]-5,8-dimethylnon-1-yn-4-yl]oxy-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C=C)CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C21H42O2Si2/c1-13-15-19(23-25(11,12)20(4,5)6)17(3)18(14-2)16-21(7,8)24(9,10)22/h1,14,17-19,22H,2,15-16H2,3-12H3/t17-,18+,19-/m1/s1 |
| InChIKey | LIYOAGGYMLYPRV-CEXWTWQISA-N |
| XLogP | 6.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|